C23H30N4OS — CID 133223626
5-(1-cyclohexylpyrrol-2-yl)-1-(oxolan-2-ylmethyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133223626) has the molecular formula C23H30N4OS and a molecular weight of 410.59 g/mol. Its IUPAC name is 5-(1-cyclohexylpyrrol-2-yl)-1-(oxolan-2-ylmethyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-(1-cyclohexylpyrrol-2-yl)-1-(oxolan-2-ylmethyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133223626 |
| Molecular Formula | C23H30N4OS |
| Molecular Weight | 410.59 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | 5-(1-cyclohexylpyrrol-2-yl)-1-(oxolan-2-ylmethyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | S=C1NC(c2ccccn2)C(c2cccn2C2CCCCC2)N1CC1CCCO1 |
| InChI | InChI=1S/C23H30N4OS/c29-23-25-21(19-11-4-5-13-24-19)22(27(23)16-18-10-7-15-28-18)20-12-6-14-26(20)17-8-2-1-3-9-17/h4-6,11-14,17-18,21-22H,1-3,7-10,15-16H2,(H,25,29) |
| InChIKey | YCHPSNAKELJTJI-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.59 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|