C19H24N4OS — CID 125076604
(4R,5S)-5-(1-ethylpyrrol-2-yl)-1-[[(2R)-oxolan-2-yl]methyl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 125076604) has the molecular formula C19H24N4OS and a molecular weight of 356.50 g/mol. Its IUPAC name is (4R,5S)-5-(1-ethylpyrrol-2-yl)-1-[[(2R)-oxolan-2-yl]methyl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4R,5S)-5-(1-ethylpyrrol-2-yl)-1-[[(2R)-oxolan-2-yl]methyl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 125076604 |
| Molecular Formula | C19H24N4OS |
| Molecular Weight | 356.50 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | (4R,5S)-5-(1-ethylpyrrol-2-yl)-1-[[(2R)-oxolan-2-yl]methyl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | CCn1cccc1[C@@H]1[C@H](c2ccccn2)NC(=S)N1C[C@H]1CCCO1 |
| InChI | InChI=1S/C19H24N4OS/c1-2-22-11-5-9-16(22)18-17(15-8-3-4-10-20-15)21-19(25)23(18)13-14-7-6-12-24-14/h3-5,8-11,14,17-18H,2,6-7,12-13H2,1H3,(H,21,25)/t14-,17+,18-/m1/s1 |
| InChIKey | BSOMAVMTENIXLT-FHLIZLRMSA-N |
| XLogP | 3.05 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.50 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|