C17H18BrN3OS2 — CID 125076560
(4S,5S)-5-(4-bromothiophen-2-yl)-1-[[(2R)-oxolan-2-yl]methyl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 125076560) has the molecular formula C17H18BrN3OS2 and a molecular weight of 424.39 g/mol. Its IUPAC name is (4S,5S)-5-(4-bromothiophen-2-yl)-1-[[(2R)-oxolan-2-yl]methyl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4S,5S)-5-(4-bromothiophen-2-yl)-1-[[(2R)-oxolan-2-yl]methyl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 125076560 |
| Molecular Formula | C17H18BrN3OS2 |
| Molecular Weight | 424.39 g/mol |
| Exact Mass | 423.01 |
| IUPAC Name | (4S,5S)-5-(4-bromothiophen-2-yl)-1-[[(2R)-oxolan-2-yl]methyl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | S=C1N[C@H](c2ccccn2)[C@@H](c2cc(Br)cs2)N1C[C@H]1CCCO1 |
| InChI | InChI=1S/C17H18BrN3OS2/c18-11-8-14(24-10-11)16-15(13-5-1-2-6-19-13)20-17(23)21(16)9-12-4-3-7-22-12/h1-2,5-6,8,10,12,15-16H,3-4,7,9H2,(H,20,23)/t12-,15-,16-/m1/s1 |
| InChIKey | AUSLSFLLBGLWLH-DAXOMENPSA-N |
| XLogP | 4.06 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.39 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|