C16H18BrN3S2 — CID 133222187
5-(4-bromothiophen-2-yl)-1-butyl-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133222187) has the molecular formula C16H18BrN3S2 and a molecular weight of 396.38 g/mol. Its IUPAC name is 5-(4-bromothiophen-2-yl)-1-butyl-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-(4-bromothiophen-2-yl)-1-butyl-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133222187 |
| Molecular Formula | C16H18BrN3S2 |
| Molecular Weight | 396.38 g/mol |
| Exact Mass | 395.01 |
| IUPAC Name | 5-(4-bromothiophen-2-yl)-1-butyl-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | CCCCN1C(=S)NC(c2ccccn2)C1c1cc(Br)cs1 |
| InChI | InChI=1S/C16H18BrN3S2/c1-2-3-8-20-15(13-9-11(17)10-22-13)14(19-16(20)21)12-6-4-5-7-18-12/h4-7,9-10,14-15H,2-3,8H2,1H3,(H,19,21) |
| InChIKey | RBTDJWKJNPSGNV-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.38 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|