C17H18BrN3S2 — CID 100522485
(4S,5S)-5-(4-bromothiophen-2-yl)-1-cyclopentyl-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100522485) has the molecular formula C17H18BrN3S2 and a molecular weight of 408.39 g/mol. Its IUPAC name is (4S,5S)-5-(4-bromothiophen-2-yl)-1-cyclopentyl-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4S,5S)-5-(4-bromothiophen-2-yl)-1-cyclopentyl-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100522485 |
| Molecular Formula | C17H18BrN3S2 |
| Molecular Weight | 408.39 g/mol |
| Exact Mass | 407.01 |
| IUPAC Name | (4S,5S)-5-(4-bromothiophen-2-yl)-1-cyclopentyl-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | S=C1N[C@H](c2ccccn2)[C@@H](c2cc(Br)cs2)N1C1CCCC1 |
| InChI | InChI=1S/C17H18BrN3S2/c18-11-9-14(23-10-11)16-15(13-7-3-4-8-19-13)20-17(22)21(16)12-5-1-2-6-12/h3-4,7-10,12,15-16H,1-2,5-6H2,(H,20,22)/t15-,16-/m1/s1 |
| InChIKey | PVGYBNMJBLMGFU-HZPDHXFCSA-N |
| XLogP | 4.82 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.39 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|