C18H21N3S2 — CID 133222689
1-cyclohexyl-4-pyridin-2-yl-5-thiophen-2-ylimidazolidine-2-thione (PubChem CID 133222689) has the molecular formula C18H21N3S2 and a molecular weight of 343.52 g/mol. Its IUPAC name is 1-cyclohexyl-4-pyridin-2-yl-5-thiophen-2-ylimidazolidine-2-thione.
| Compound Name | 1-cyclohexyl-4-pyridin-2-yl-5-thiophen-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133222689 |
| Molecular Formula | C18H21N3S2 |
| Molecular Weight | 343.52 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 1-cyclohexyl-4-pyridin-2-yl-5-thiophen-2-ylimidazolidine-2-thione |
| SMILES | S=C1NC(c2ccccn2)C(c2cccs2)N1C1CCCCC1 |
| InChI | InChI=1S/C18H21N3S2/c22-18-20-16(14-9-4-5-11-19-14)17(15-10-6-12-23-15)21(18)13-7-2-1-3-8-13/h4-6,9-13,16-17H,1-3,7-8H2,(H,20,22) |
| InChIKey | QPEPFGSXJOSASY-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.52 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|