C17H19N3OS — CID 100522235
(4S,5R)-1-cyclopentyl-5-(furan-2-yl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100522235) has the molecular formula C17H19N3OS and a molecular weight of 313.43 g/mol. Its IUPAC name is (4S,5R)-1-cyclopentyl-5-(furan-2-yl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4S,5R)-1-cyclopentyl-5-(furan-2-yl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100522235 |
| Molecular Formula | C17H19N3OS |
| Molecular Weight | 313.43 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | (4S,5R)-1-cyclopentyl-5-(furan-2-yl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | S=C1N[C@H](c2ccccn2)[C@H](c2ccco2)N1C1CCCC1 |
| InChI | InChI=1S/C17H19N3OS/c22-17-19-15(13-8-3-4-10-18-13)16(14-9-5-11-21-14)20(17)12-6-1-2-7-12/h3-5,8-12,15-16H,1-2,6-7H2,(H,19,22)/t15-,16+/m1/s1 |
| InChIKey | WGWUYEILIXJMRZ-CVEARBPZSA-N |
| XLogP | 3.59 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.43 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|