C24H25N3OS2 — CID 100523856
(4S,5S)-1-cyclopentyl-5-[5-(4-methylphenyl)sulfanylfuran-2-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100523856) has the molecular formula C24H25N3OS2 and a molecular weight of 435.62 g/mol. Its IUPAC name is (4S,5S)-1-cyclopentyl-5-[5-(4-methylphenyl)sulfanylfuran-2-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4S,5S)-1-cyclopentyl-5-[5-(4-methylphenyl)sulfanylfuran-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100523856 |
| Molecular Formula | C24H25N3OS2 |
| Molecular Weight | 435.62 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | (4S,5S)-1-cyclopentyl-5-[5-(4-methylphenyl)sulfanylfuran-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1ccc(Sc2ccc([C@@H]3[C@@H](c4ccccn4)NC(=S)N3C3CCCC3)o2)cc1 |
| InChI | InChI=1S/C24H25N3OS2/c1-16-9-11-18(12-10-16)30-21-14-13-20(28-21)23-22(19-8-4-5-15-25-19)26-24(29)27(23)17-6-2-3-7-17/h4-5,8-15,17,22-23H,2-3,6-7H2,1H3,(H,26,29)/t22-,23-/m1/s1 |
| InChIKey | OWLBNRJBHXROAS-DHIUTWEWSA-N |
| XLogP | 6.05 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.62 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|