C27H25N3O3S2 — CID 133178180
1-(2,4-dimethoxyphenyl)-5-[5-(4-methylphenyl)sulfanylfuran-2-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133178180) has the molecular formula C27H25N3O3S2 and a molecular weight of 503.65 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-5-[5-(4-methylphenyl)sulfanylfuran-2-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 1-(2,4-dimethoxyphenyl)-5-[5-(4-methylphenyl)sulfanylfuran-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133178180 |
| Molecular Formula | C27H25N3O3S2 |
| Molecular Weight | 503.65 g/mol |
| Exact Mass | 503.13 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-5-[5-(4-methylphenyl)sulfanylfuran-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | COc1ccc(N2C(=S)NC(c3ccccn3)C2c2ccc(Sc3ccc(C)cc3)o2)c(OC)c1 |
| InChI | InChI=1S/C27H25N3O3S2/c1-17-7-10-19(11-8-17)35-24-14-13-22(33-24)26-25(20-6-4-5-15-28-20)29-27(34)30(26)21-12-9-18(31-2)16-23(21)32-3/h4-16,25-26H,1-3H3,(H,29,34) |
| InChIKey | QVJOAALPICSIOX-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 59.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.65 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|