C18H22N4OS — CID 133223679
5-(5-methyl-1H-pyrrol-2-yl)-1-(oxolan-2-ylmethyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133223679) has the molecular formula C18H22N4OS and a molecular weight of 342.47 g/mol. Its IUPAC name is 5-(5-methyl-1H-pyrrol-2-yl)-1-(oxolan-2-ylmethyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-(5-methyl-1H-pyrrol-2-yl)-1-(oxolan-2-ylmethyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133223679 |
| Molecular Formula | C18H22N4OS |
| Molecular Weight | 342.47 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 5-(5-methyl-1H-pyrrol-2-yl)-1-(oxolan-2-ylmethyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1ccc(C2C(c3ccccn3)NC(=S)N2CC2CCCO2)[nH]1 |
| InChI | InChI=1S/C18H22N4OS/c1-12-7-8-15(20-12)17-16(14-6-2-3-9-19-14)21-18(24)22(17)11-13-5-4-10-23-13/h2-3,6-9,13,16-17,20H,4-5,10-11H2,1H3,(H,21,24) |
| InChIKey | AFQCWMRGPFVPLZ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 53.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.47 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|