C16H20N4S — CID 133222005
5-(5-methyl-1H-pyrrol-2-yl)-1-propyl-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133222005) has the molecular formula C16H20N4S and a molecular weight of 300.43 g/mol. Its IUPAC name is 5-(5-methyl-1H-pyrrol-2-yl)-1-propyl-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-(5-methyl-1H-pyrrol-2-yl)-1-propyl-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133222005 |
| Molecular Formula | C16H20N4S |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 5-(5-methyl-1H-pyrrol-2-yl)-1-propyl-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | CCCN1C(=S)NC(c2ccccn2)C1c1ccc(C)[nH]1 |
| InChI | InChI=1S/C16H20N4S/c1-3-10-20-15(13-8-7-11(2)18-13)14(19-16(20)21)12-6-4-5-9-17-12/h4-9,14-15,18H,3,10H2,1-2H3,(H,19,21) |
| InChIKey | CYKQWQQVRDUPBO-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|