C19H16ClN3S2 — CID 133181017
1-benzyl-5-(5-chlorothiophen-2-yl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133181017) has the molecular formula C19H16ClN3S2 and a molecular weight of 385.95 g/mol. Its IUPAC name is 1-benzyl-5-(5-chlorothiophen-2-yl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 1-benzyl-5-(5-chlorothiophen-2-yl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133181017 |
| Molecular Formula | C19H16ClN3S2 |
| Molecular Weight | 385.95 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | 1-benzyl-5-(5-chlorothiophen-2-yl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | S=C1NC(c2ccccn2)C(c2ccc(Cl)s2)N1Cc1ccccc1 |
| InChI | InChI=1S/C19H16ClN3S2/c20-16-10-9-15(25-16)18-17(14-8-4-5-11-21-14)22-19(24)23(18)12-13-6-2-1-3-7-13/h1-11,17-18H,12H2,(H,22,24) |
| InChIKey | MLSIKUKYPREDJY-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.95 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|