C23H23ClN4OS2 — CID 100672016
3-[(4R,5S)-5-(5-chlorothiophen-2-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-ethylphenyl)propanamide (PubChem CID 100672016) has the molecular formula C23H23ClN4OS2 and a molecular weight of 471.05 g/mol. Its IUPAC name is 3-[(4R,5S)-5-(5-chlorothiophen-2-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-ethylphenyl)propanamide.
| Compound Name | 3-[(4R,5S)-5-(5-chlorothiophen-2-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-ethylphenyl)propanamide |
|---|---|
| PubChem CID | 100672016 |
| Molecular Formula | C23H23ClN4OS2 |
| Molecular Weight | 471.05 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | 3-[(4R,5S)-5-(5-chlorothiophen-2-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-ethylphenyl)propanamide |
| SMILES | CCc1ccccc1NC(=O)CCN1C(=S)N[C@@H](c2ccccn2)[C@H]1c1ccc(Cl)s1 |
| InChI | InChI=1S/C23H23ClN4OS2/c1-2-15-7-3-4-8-16(15)26-20(29)12-14-28-22(18-10-11-19(24)31-18)21(27-23(28)30)17-9-5-6-13-25-17/h3-11,13,21-22H,2,12,14H2,1H3,(H,26,29)(H,27,30)/t21-,22+/m0/s1 |
| InChIKey | GXGVMTGRKWAQLH-FCHUYYIVSA-N |
| XLogP | 5.36 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.05 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|