C30H31N5OS — CID 100679172
N-(2-ethylphenyl)-3-[(4S,5R)-5-(5-methyl-1-phenylpyrrol-2-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanamide (PubChem CID 100679172) has the molecular formula C30H31N5OS and a molecular weight of 509.68 g/mol. Its IUPAC name is N-(2-ethylphenyl)-3-[(4S,5R)-5-(5-methyl-1-phenylpyrrol-2-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanamide.
| Compound Name | N-(2-ethylphenyl)-3-[(4S,5R)-5-(5-methyl-1-phenylpyrrol-2-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanamide |
|---|---|
| PubChem CID | 100679172 |
| Molecular Formula | C30H31N5OS |
| Molecular Weight | 509.68 g/mol |
| Exact Mass | 509.22 |
| IUPAC Name | N-(2-ethylphenyl)-3-[(4S,5R)-5-(5-methyl-1-phenylpyrrol-2-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanamide |
| SMILES | CCc1ccccc1NC(=O)CCN1C(=S)N[C@H](c2ccccn2)[C@@H]1c1ccc(C)n1-c1ccccc1 |
| InChI | InChI=1S/C30H31N5OS/c1-3-22-11-7-8-14-24(22)32-27(36)18-20-34-29(28(33-30(34)37)25-15-9-10-19-31-25)26-17-16-21(2)35(26)23-12-5-4-6-13-23/h4-17,19,28-29H,3,18,20H2,1-2H3,(H,32,36)(H,33,37)/t28-,29+/m1/s1 |
| InChIKey | OLKVJVFIIMVTTL-WDYNHAJCSA-N |
| XLogP | 5.74 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.68 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|