C22H21ClN4O2S2 — CID 100713943
3-[(4R,5S)-5-(5-chlorothiophen-2-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-methoxyphenyl)propanamide (PubChem CID 100713943) has the molecular formula C22H21ClN4O2S2 and a molecular weight of 473.02 g/mol. Its IUPAC name is 3-[(4R,5S)-5-(5-chlorothiophen-2-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-methoxyphenyl)propanamide.
| Compound Name | 3-[(4R,5S)-5-(5-chlorothiophen-2-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 100713943 |
| Molecular Formula | C22H21ClN4O2S2 |
| Molecular Weight | 473.02 g/mol |
| Exact Mass | 472.08 |
| IUPAC Name | 3-[(4R,5S)-5-(5-chlorothiophen-2-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-methoxyphenyl)propanamide |
| SMILES | COc1ccccc1NC(=O)CCN1C(=S)N[C@@H](c2ccccn2)[C@H]1c1ccc(Cl)s1 |
| InChI | InChI=1S/C22H21ClN4O2S2/c1-29-16-8-3-2-6-14(16)25-19(28)11-13-27-21(17-9-10-18(23)31-17)20(26-22(27)30)15-7-4-5-12-24-15/h2-10,12,20-21H,11,13H2,1H3,(H,25,28)(H,26,30)/t20-,21+/m0/s1 |
| InChIKey | LAKUBLXXAFUNNG-LEWJYISDSA-N |
| XLogP | 4.81 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.02 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|