C31H21ClN4O5S2 — CID 133178120
4-chloro-3-[5-[3-[4-(4-nitrophenyl)sulfanylphenyl]-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoic acid (PubChem CID 133178120) has the molecular formula C31H21ClN4O5S2 and a molecular weight of 629.12 g/mol. Its IUPAC name is 4-chloro-3-[5-[3-[4-(4-nitrophenyl)sulfanylphenyl]-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoic acid.
| Compound Name | 4-chloro-3-[5-[3-[4-(4-nitrophenyl)sulfanylphenyl]-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 133178120 |
| Molecular Formula | C31H21ClN4O5S2 |
| Molecular Weight | 629.12 g/mol |
| Exact Mass | 628.06 |
| IUPAC Name | 4-chloro-3-[5-[3-[4-(4-nitrophenyl)sulfanylphenyl]-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(Cl)c(-c2ccc(C3C(c4ccccn4)NC(=S)N3c3ccc(Sc4ccc([N+](=O)[O-])cc4)cc3)o2)c1 |
| InChI | InChI=1S/C31H21ClN4O5S2/c32-24-13-4-18(30(37)38)17-23(24)26-14-15-27(41-26)29-28(25-3-1-2-16-33-25)34-31(42)35(29)19-5-9-21(10-6-19)43-22-11-7-20(8-12-22)36(39)40/h1-17,28-29H,(H,34,42)(H,37,38) |
| InChIKey | HOHSOCFBDDWAGN-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 121.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.12 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|