C25H20N4O3S2 — CID 133183938
5-(5-methylfuran-2-yl)-1-[4-(4-nitrophenyl)sulfanylphenyl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133183938) has the molecular formula C25H20N4O3S2 and a molecular weight of 488.59 g/mol. Its IUPAC name is 5-(5-methylfuran-2-yl)-1-[4-(4-nitrophenyl)sulfanylphenyl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-(5-methylfuran-2-yl)-1-[4-(4-nitrophenyl)sulfanylphenyl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133183938 |
| Molecular Formula | C25H20N4O3S2 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | 5-(5-methylfuran-2-yl)-1-[4-(4-nitrophenyl)sulfanylphenyl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1ccc(C2C(c3ccccn3)NC(=S)N2c2ccc(Sc3ccc([N+](=O)[O-])cc3)cc2)o1 |
| InChI | InChI=1S/C25H20N4O3S2/c1-16-5-14-22(32-16)24-23(21-4-2-3-15-26-21)27-25(33)28(24)17-6-10-19(11-7-17)34-20-12-8-18(9-13-20)29(30)31/h2-15,23-24H,1H3,(H,27,33) |
| InChIKey | FFSJDUMJACTHHH-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 84.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|