C26H23N5O2S2 — CID 133184023
5-(2,5-dimethyl-1H-pyrrol-3-yl)-1-[4-(4-nitrophenyl)sulfanylphenyl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133184023) has the molecular formula C26H23N5O2S2 and a molecular weight of 501.64 g/mol. Its IUPAC name is 5-(2,5-dimethyl-1H-pyrrol-3-yl)-1-[4-(4-nitrophenyl)sulfanylphenyl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-(2,5-dimethyl-1H-pyrrol-3-yl)-1-[4-(4-nitrophenyl)sulfanylphenyl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133184023 |
| Molecular Formula | C26H23N5O2S2 |
| Molecular Weight | 501.64 g/mol |
| Exact Mass | 501.13 |
| IUPAC Name | 5-(2,5-dimethyl-1H-pyrrol-3-yl)-1-[4-(4-nitrophenyl)sulfanylphenyl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1cc(C2C(c3ccccn3)NC(=S)N2c2ccc(Sc3ccc([N+](=O)[O-])cc3)cc2)c(C)[nH]1 |
| InChI | InChI=1S/C26H23N5O2S2/c1-16-15-22(17(2)28-16)25-24(23-5-3-4-14-27-23)29-26(34)30(25)18-6-10-20(11-7-18)35-21-12-8-19(9-13-21)31(32)33/h3-15,24-25,28H,1-2H3,(H,29,34) |
| InChIKey | BEGNHHVQWSSHRS-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 87.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.64 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|