C26H21BrFN3OS — CID 133158677
5-[5-(2-bromo-4-fluorophenyl)furan-2-yl]-1-(4-ethylphenyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133158677) has the molecular formula C26H21BrFN3OS and a molecular weight of 522.44 g/mol. Its IUPAC name is 5-[5-(2-bromo-4-fluorophenyl)furan-2-yl]-1-(4-ethylphenyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-[5-(2-bromo-4-fluorophenyl)furan-2-yl]-1-(4-ethylphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133158677 |
| Molecular Formula | C26H21BrFN3OS |
| Molecular Weight | 522.44 g/mol |
| Exact Mass | 521.06 |
| IUPAC Name | 5-[5-(2-bromo-4-fluorophenyl)furan-2-yl]-1-(4-ethylphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | CCc1ccc(N2C(=S)NC(c3ccccn3)C2c2ccc(-c3ccc(F)cc3Br)o2)cc1 |
| InChI | InChI=1S/C26H21BrFN3OS/c1-2-16-6-9-18(10-7-16)31-25(24(30-26(31)33)21-5-3-4-14-29-21)23-13-12-22(32-23)19-11-8-17(28)15-20(19)27/h3-15,24-25H,2H2,1H3,(H,30,33) |
| InChIKey | UAOUQMGVZPLEIF-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.44 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|