C27H24BrN3O2S — CID 133224392
1-(4-bromo-3-methylphenyl)-5-[5-(4-ethoxyphenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133224392) has the molecular formula C27H24BrN3O2S and a molecular weight of 534.48 g/mol. Its IUPAC name is 1-(4-bromo-3-methylphenyl)-5-[5-(4-ethoxyphenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 1-(4-bromo-3-methylphenyl)-5-[5-(4-ethoxyphenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133224392 |
| Molecular Formula | C27H24BrN3O2S |
| Molecular Weight | 534.48 g/mol |
| Exact Mass | 533.08 |
| IUPAC Name | 1-(4-bromo-3-methylphenyl)-5-[5-(4-ethoxyphenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | CCOc1ccc(-c2ccc(C3C(c4ccccn4)NC(=S)N3c3ccc(Br)c(C)c3)o2)cc1 |
| InChI | InChI=1S/C27H24BrN3O2S/c1-3-32-20-10-7-18(8-11-20)23-13-14-24(33-23)26-25(22-6-4-5-15-29-22)30-27(34)31(26)19-9-12-21(28)17(2)16-19/h4-16,25-26H,3H2,1-2H3,(H,30,34) |
| InChIKey | NBNDUURILOPIRF-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 50.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.48 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|