C33H29N3O3S — CID 133183799
5-[5-(4-ethoxyphenyl)furan-2-yl]-1-[4-(4-methylphenoxy)phenyl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133183799) has the molecular formula C33H29N3O3S and a molecular weight of 547.68 g/mol. Its IUPAC name is 5-[5-(4-ethoxyphenyl)furan-2-yl]-1-[4-(4-methylphenoxy)phenyl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-[5-(4-ethoxyphenyl)furan-2-yl]-1-[4-(4-methylphenoxy)phenyl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133183799 |
| Molecular Formula | C33H29N3O3S |
| Molecular Weight | 547.68 g/mol |
| Exact Mass | 547.19 |
| IUPAC Name | 5-[5-(4-ethoxyphenyl)furan-2-yl]-1-[4-(4-methylphenoxy)phenyl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | CCOc1ccc(-c2ccc(C3C(c4ccccn4)NC(=S)N3c3ccc(Oc4ccc(C)cc4)cc3)o2)cc1 |
| InChI | InChI=1S/C33H29N3O3S/c1-3-37-25-15-9-23(10-16-25)29-19-20-30(39-29)32-31(28-6-4-5-21-34-28)35-33(40)36(32)24-11-17-27(18-12-24)38-26-13-7-22(2)8-14-26/h4-21,31-32H,3H2,1-2H3,(H,35,40) |
| InChIKey | XXKHNAACMPJLBU-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 59.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.68 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|