C24H16Cl2FN3OS — CID 133182463
5-[5-(2,4-dichlorophenyl)furan-2-yl]-1-(2-fluorophenyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133182463) has the molecular formula C24H16Cl2FN3OS and a molecular weight of 484.38 g/mol. Its IUPAC name is 5-[5-(2,4-dichlorophenyl)furan-2-yl]-1-(2-fluorophenyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-[5-(2,4-dichlorophenyl)furan-2-yl]-1-(2-fluorophenyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133182463 |
| Molecular Formula | C24H16Cl2FN3OS |
| Molecular Weight | 484.38 g/mol |
| Exact Mass | 483.04 |
| IUPAC Name | 5-[5-(2,4-dichlorophenyl)furan-2-yl]-1-(2-fluorophenyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Fc1ccccc1N1C(=S)NC(c2ccccn2)C1c1ccc(-c2ccc(Cl)cc2Cl)o1 |
| InChI | InChI=1S/C24H16Cl2FN3OS/c25-14-8-9-15(16(26)13-14)20-10-11-21(31-20)23-22(18-6-3-4-12-28-18)29-24(32)30(23)19-7-2-1-5-17(19)27/h1-13,22-23H,(H,29,32) |
| InChIKey | ONTCSNSHXJAEFD-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.38 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|