C22H15Cl2NO4S — CID 18839692
(5E)-5-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-3-(4-ethoxyphenyl)-1,3-thiazolidine-2,4-dione (PubChem CID 18839692) has the molecular formula C22H15Cl2NO4S and a molecular weight of 460.34 g/mol. Its IUPAC name is (5E)-5-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-3-(4-ethoxyphenyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-3-(4-ethoxyphenyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 18839692 |
| Molecular Formula | C22H15Cl2NO4S |
| Molecular Weight | 460.34 g/mol |
| Exact Mass | 459.01 |
| IUPAC Name | (5E)-5-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-3-(4-ethoxyphenyl)-1,3-thiazolidine-2,4-dione |
| SMILES | CCOc1ccc(N2C(=O)S/C(=C/c3ccc(-c4cc(Cl)ccc4Cl)o3)C2=O)cc1 |
| InChI | InChI=1S/C22H15Cl2NO4S/c1-2-28-15-6-4-14(5-7-15)25-21(26)20(30-22(25)27)12-16-8-10-19(29-16)17-11-13(23)3-9-18(17)24/h3-12H,2H2,1H3/b20-12+ |
| InChIKey | WTIOXEIFAVCDGL-UDWIEESQSA-N |
| XLogP | 6.89 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.34 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|