C14H23N — CID 177158667
N-(2,6-diethylphenyl)ethanimine;ethane (PubChem CID 177158667) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is N-(2,6-diethylphenyl)ethanimine;ethane.
| Compound Name | N-(2,6-diethylphenyl)ethanimine;ethane |
|---|---|
| PubChem CID | 177158667 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | N-(2,6-diethylphenyl)ethanimine;ethane |
| SMILES | C/C=N/c1c(CC)cccc1CC.CC |
| InChI | InChI=1S/C12H17N.C2H6/c1-4-10-8-7-9-11(5-2)12(10)13-6-3;1-2/h6-9H,4-5H2,1-3H3;1-2H3/b13-6+; |
| InChIKey | ODGLBCKFPUDCKO-AWFSDRIXSA-N |
| XLogP | 4.56 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|