About (5-methyl-1,2-oxazol-3-yl)methyl N'-(2,6-diethylphenyl)carbamimidothioate;hydrochloride
(5-methyl-1,2-oxazol-3-yl)methyl N'-(2,6-diethylphenyl)carbamimidothioate;hydrochloride (PubChem CID 71901324) has the molecular formula C16H22ClN3OS
and a molecular weight of 339.89 g/mol. Its IUPAC name is (5-methyl-1,2-oxazol-3-yl)methyl N'-(2,6-diethylphenyl)carbamimidothioate;hydrochloride.
Molecular Properties
| Compound Name | (5-methyl-1,2-oxazol-3-yl)methyl N'-(2,6-diethylphenyl)carbamimidothioate;hydrochloride |
| PubChem CID | 71901324 |
| Molecular Formula | C16H22ClN3OS |
| Molecular Weight | 339.89 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | (5-methyl-1,2-oxazol-3-yl)methyl N'-(2,6-diethylphenyl)carbamimidothioate;hydrochloride |
| SMILES | CCc1cccc(CC)c1/N=C(/N)SCc1cc(C)on1.Cl |
| InChI | InChI=1S/C16H21N3OS.ClH/c1-4-12-7-6-8-13(5-2)15(12)18-16(17)21-10-14-9-11(3)20-19-14;/h6-9H,4-5,10H2,1-3H3,(H2,17,18);1H |
| InChIKey | VFYTUWZNYCPITA-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 64.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.89 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (5-methyl-1,2-oxazol-3-yl)methyl N'-(2,6-diethylphenyl)carbamimidothioate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methyl-1,2-oxazol-3-yl)methyl N'-(2,6-diethylphenyl)carbamimidothioate;hydrochloride?
The IUPAC name of (5-methyl-1,2-oxazol-3-yl)methyl N'-(2,6-diethylphenyl)carbamimidothioate;hydrochloride (CID 71901324) is (5-methyl-1,2-oxazol-3-yl)methyl N'-(2,6-diethylphenyl)carbamimidothioate;hydrochloride.
What is the SMILES notation for (5-methyl-1,2-oxazol-3-yl)methyl N'-(2,6-diethylphenyl)carbamimidothioate;hydrochloride?
The canonical SMILES for (5-methyl-1,2-oxazol-3-yl)methyl N'-(2,6-diethylphenyl)carbamimidothioate;hydrochloride is CCc1cccc(CC)c1/N=C(/N)SCc1cc(C)on1.Cl.
What is the InChIKey of (5-methyl-1,2-oxazol-3-yl)methyl N'-(2,6-diethylphenyl)carbamimidothioate;hydrochloride?
The InChIKey is VFYTUWZNYCPITA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N3OS.ClH/c1-4-12-7-6-8-13(5-2)15(12)18-16(17)21-10-14-9-11(3)20-19-14;/h6-9H,4-5,10H2,1-3H3,(H2,17,18);1H.
What are the key properties of (5-methyl-1,2-oxazol-3-yl)methyl N'-(2,6-diethylphenyl)carbamimidothioate;hydrochloride?
(5-methyl-1,2-oxazol-3-yl)methyl N'-(2,6-diethylphenyl)carbamimidothioate;hydrochloride has a molecular weight of 339.89 g/mol, XLogP of 4.41, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methyl-1,2-oxazol-3-yl)methyl N'-(2,6-diethylphenyl)carbamimidothioate;hydrochloride is sourced from PubChem (CID 71901324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).