C16H22ClN3OS — CID 71901324
(5-methyl-1,2-oxazol-3-yl)methyl N'-(2,6-diethylphenyl)carbamimidothioate;hydrochloride (PubChem CID 71901324) has the molecular formula C16H22ClN3OS and a molecular weight of 339.89 g/mol. Its IUPAC name is (5-methyl-1,2-oxazol-3-yl)methyl N'-(2,6-diethylphenyl)carbamimidothioate;hydrochloride.
| Compound Name | (5-methyl-1,2-oxazol-3-yl)methyl N'-(2,6-diethylphenyl)carbamimidothioate;hydrochloride |
|---|---|
| PubChem CID | 71901324 |
| Molecular Formula | C16H22ClN3OS |
| Molecular Weight | 339.89 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | (5-methyl-1,2-oxazol-3-yl)methyl N'-(2,6-diethylphenyl)carbamimidothioate;hydrochloride |
| SMILES | CCc1cccc(CC)c1/N=C(/N)SCc1cc(C)on1.Cl |
| InChI | InChI=1S/C16H21N3OS.ClH/c1-4-12-7-6-8-13(5-2)15(12)18-16(17)21-10-14-9-11(3)20-19-14;/h6-9H,4-5,10H2,1-3H3,(H2,17,18);1H |
| InChIKey | VFYTUWZNYCPITA-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 64.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.89 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|