C11H11ClN2OS — CID 43305486
3-chloro-4-[(5-methyl-1,2-oxazol-3-yl)methylsulfanyl]aniline (PubChem CID 43305486) has the molecular formula C11H11ClN2OS and a molecular weight of 254.74 g/mol. Its IUPAC name is 3-chloro-4-[(5-methyl-1,2-oxazol-3-yl)methylsulfanyl]aniline.
| Compound Name | 3-chloro-4-[(5-methyl-1,2-oxazol-3-yl)methylsulfanyl]aniline |
|---|---|
| PubChem CID | 43305486 |
| Molecular Formula | C11H11ClN2OS |
| Molecular Weight | 254.74 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 3-chloro-4-[(5-methyl-1,2-oxazol-3-yl)methylsulfanyl]aniline |
| SMILES | Cc1cc(CSc2ccc(N)cc2Cl)no1 |
| InChI | InChI=1S/C11H11ClN2OS/c1-7-4-9(14-15-7)6-16-11-3-2-8(13)5-10(11)12/h2-5H,6,13H2,1H3 |
| InChIKey | UKWIPZWFNZJVPC-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.74 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|