C10H11ClN6S — CID 43305266
6-[(4-amino-2-chlorophenyl)sulfanylmethyl]-1,3,5-triazine-2,4-diamine (PubChem CID 43305266) has the molecular formula C10H11ClN6S and a molecular weight of 282.76 g/mol. Its IUPAC name is 6-[(4-amino-2-chlorophenyl)sulfanylmethyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[(4-amino-2-chlorophenyl)sulfanylmethyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 43305266 |
| Molecular Formula | C10H11ClN6S |
| Molecular Weight | 282.76 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | 6-[(4-amino-2-chlorophenyl)sulfanylmethyl]-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1ccc(SCc2nc(N)nc(N)n2)c(Cl)c1 |
| InChI | InChI=1S/C10H11ClN6S/c11-6-3-5(12)1-2-7(6)18-4-8-15-9(13)17-10(14)16-8/h1-3H,4,12H2,(H4,13,14,15,16,17) |
| InChIKey | FWNSBGGICAYBIJ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 116.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.76 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|