C13H11ClN2O2S — CID 106903508
6-[(4-amino-2-chlorophenyl)sulfanylmethyl]pyridine-2-carboxylic acid (PubChem CID 106903508) has the molecular formula C13H11ClN2O2S and a molecular weight of 294.76 g/mol. Its IUPAC name is 6-[(4-amino-2-chlorophenyl)sulfanylmethyl]pyridine-2-carboxylic acid.
| Compound Name | 6-[(4-amino-2-chlorophenyl)sulfanylmethyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 106903508 |
| Molecular Formula | C13H11ClN2O2S |
| Molecular Weight | 294.76 g/mol |
| Exact Mass | 294.02 |
| IUPAC Name | 6-[(4-amino-2-chlorophenyl)sulfanylmethyl]pyridine-2-carboxylic acid |
| SMILES | Nc1ccc(SCc2cccc(C(=O)O)n2)c(Cl)c1 |
| InChI | InChI=1S/C13H11ClN2O2S/c14-10-6-8(15)4-5-12(10)19-7-9-2-1-3-11(16-9)13(17)18/h1-6H,7,15H2,(H,17,18) |
| InChIKey | MWWKWZITYHONOG-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.76 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|