C9H7Cl2N3S2 — CID 80606339
3-chloro-4-[(5-chloro-1,3,4-thiadiazol-2-yl)methylsulfanyl]aniline (PubChem CID 80606339) has the molecular formula C9H7Cl2N3S2 and a molecular weight of 292.22 g/mol. Its IUPAC name is 3-chloro-4-[(5-chloro-1,3,4-thiadiazol-2-yl)methylsulfanyl]aniline.
| Compound Name | 3-chloro-4-[(5-chloro-1,3,4-thiadiazol-2-yl)methylsulfanyl]aniline |
|---|---|
| PubChem CID | 80606339 |
| Molecular Formula | C9H7Cl2N3S2 |
| Molecular Weight | 292.22 g/mol |
| Exact Mass | 290.95 |
| IUPAC Name | 3-chloro-4-[(5-chloro-1,3,4-thiadiazol-2-yl)methylsulfanyl]aniline |
| SMILES | Nc1ccc(SCc2nnc(Cl)s2)c(Cl)c1 |
| InChI | InChI=1S/C9H7Cl2N3S2/c10-6-3-5(12)1-2-7(6)15-4-8-13-14-9(11)16-8/h1-3H,4,12H2 |
| InChIKey | JJYSGFSEMRVAAA-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.22 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|