C54H44N2 — CID 132837350
1-N,2-N-bis(2-benzhydryl-4,6-dimethylphenyl)acenaphthylene-1,2-diimine (PubChem CID 132837350) has the molecular formula C54H44N2 and a molecular weight of 720.96 g/mol. Its IUPAC name is 1-N,2-N-bis(2-benzhydryl-4,6-dimethylphenyl)acenaphthylene-1,2-diimine.
| Compound Name | 1-N,2-N-bis(2-benzhydryl-4,6-dimethylphenyl)acenaphthylene-1,2-diimine |
|---|---|
| PubChem CID | 132837350 |
| Molecular Formula | C54H44N2 |
| Molecular Weight | 720.96 g/mol |
| Exact Mass | 720.35 |
| IUPAC Name | 1-N,2-N-bis(2-benzhydryl-4,6-dimethylphenyl)acenaphthylene-1,2-diimine |
| SMILES | Cc1cc(C)c(/N=C2C(=N/c3c(C)cc(C)cc3C(c3ccccc3)c3ccccc3)/c3cccc4cccc/2c34)c(C(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C54H44N2/c1-35-31-37(3)51(46(33-35)48(39-19-9-5-10-20-39)40-21-11-6-12-22-40)55-53-44-29-17-27-43-28-18-30-45(50(43)44)54(53)56-52-38(4)32-36(2)34-47(52)49(41-23-13-7-14-24-41)42-25-15-8-16-26-42/h5-34,48-49H,1-4H3/b55-53+,56-54+ |
| InChIKey | UMEZNUUIBLHYRA-DSZBTAPASA-N |
| XLogP | 13.69 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.96 |
| LogP ≤ 5 | 13.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|