C59H52N2 — CID 166445948
CID 166445948 (PubChem CID 166445948) has the molecular formula C59H52N2 and a molecular weight of 789.08 g/mol.
| Compound Name | CID 166445948 |
|---|---|
| PubChem CID | 166445948 |
| Molecular Formula | C59H52N2 |
| Molecular Weight | 789.08 g/mol |
| Exact Mass | 788.41 |
| IUPAC Name | — |
| SMILES | Cc1cc(C(C)c2ccccc2)c(N2[C]N(c3c(C(C)c4ccccc4)cc(C)cc3[C@@H](C)c3ccccc3)C3=C2c2cccc4cccc3c24)c([C@@H](C)c2ccccc2)c1 |
| InChI | InChI=1S/C59H52N2/c1-38-33-51(40(3)44-21-11-7-12-22-44)56(52(34-38)41(4)45-23-13-8-14-24-45)60-37-61(59-50-32-20-30-48-29-19-31-49(55(48)50)58(59)60)57-53(42(5)46-25-15-9-16-26-46)35-39(2)36-54(57)43(6)47-27-17-10-18-28-47/h7-36,40-43H,1-6H3/t40-,41?,42-,43?/m0/s1 |
| InChIKey | VEMYKCWLGIYQGQ-NUQUFKDFSA-N |
| XLogP | 15.23 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.08 |
| LogP ≤ 5 | 15.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |