About CID 166445948
CID 166445948 (PubChem CID 166445948) has the molecular formula C59H52N2
and a molecular weight of 789.08 g/mol.
Molecular Properties
| Compound Name | CID 166445948 |
| PubChem CID | 166445948 |
| Molecular Formula | C59H52N2 |
| Molecular Weight | 789.08 g/mol |
| Exact Mass | 788.41 |
| IUPAC Name | — |
| SMILES | Cc1cc(C(C)c2ccccc2)c(N2[C]N(c3c(C(C)c4ccccc4)cc(C)cc3[C@@H](C)c3ccccc3)C3=C2c2cccc4cccc3c24)c([C@@H](C)c2ccccc2)c1 |
| InChI | InChI=1S/C59H52N2/c1-38-33-51(40(3)44-21-11-7-12-22-44)56(52(34-38)41(4)45-23-13-8-14-24-45)60-37-61(59-50-32-20-30-48-29-19-31-49(55(48)50)58(59)60)57-53(42(5)46-25-15-9-16-26-46)35-39(2)36-54(57)43(6)47-27-17-10-18-28-47/h7-36,40-43H,1-6H3/t40-,41?,42-,43?/m0/s1 |
| InChIKey | VEMYKCWLGIYQGQ-NUQUFKDFSA-N |
| XLogP | 15.23 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 61 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 789.08 |
| LogP ≤ 5 | 15.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 166445948 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 166445948?
The IUPAC name of CID 166445948 (CID 166445948) is not available.
What is the SMILES notation for CID 166445948?
The canonical SMILES for CID 166445948 is Cc1cc(C(C)c2ccccc2)c(N2[C]N(c3c(C(C)c4ccccc4)cc(C)cc3[C@@H](C)c3ccccc3)C3=C2c2cccc4cccc3c24)c([C@@H](C)c2ccccc2)c1.
What is the InChIKey of CID 166445948?
The InChIKey is VEMYKCWLGIYQGQ-NUQUFKDFSA-N. The full InChI is InChI=1S/C59H52N2/c1-38-33-51(40(3)44-21-11-7-12-22-44)56(52(34-38)41(4)45-23-13-8-14-24-45)60-37-61(59-50-32-20-30-48-29-19-31-49(55(48)50)58(59)60)57-53(42(5)46-25-15-9-16-26-46)35-39(2)36-54(57)43(6)47-27-17-10-18-28-47/h7-36,40-43H,1-6H3/t40-,41?,42-,43?/m0/s1.
What are the key properties of CID 166445948?
CID 166445948 has a molecular weight of 789.08 g/mol, XLogP of 15.23, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 166445948 is sourced from PubChem (CID 166445948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).