C19H18Br4N2S2 — CID 158224425
2-N,3-N-bis(2,6-dibromo-4-methylphenyl)-1,4-dithiane-2,3-diimine;methane (PubChem CID 158224425) has the molecular formula C19H18Br4N2S2 and a molecular weight of 658.12 g/mol. Its IUPAC name is 2-N,3-N-bis(2,6-dibromo-4-methylphenyl)-1,4-dithiane-2,3-diimine;methane.
| Compound Name | 2-N,3-N-bis(2,6-dibromo-4-methylphenyl)-1,4-dithiane-2,3-diimine;methane |
|---|---|
| PubChem CID | 158224425 |
| Molecular Formula | C19H18Br4N2S2 |
| Molecular Weight | 658.12 g/mol |
| Exact Mass | 653.76 |
| IUPAC Name | 2-N,3-N-bis(2,6-dibromo-4-methylphenyl)-1,4-dithiane-2,3-diimine;methane |
| SMILES | C.Cc1cc(Br)c(/N=C2\SCCS\C2=N/c2c(Br)cc(C)cc2Br)c(Br)c1 |
| InChI | InChI=1S/C18H14Br4N2S2.CH4/c1-9-5-11(19)15(12(20)6-9)23-17-18(26-4-3-25-17)24-16-13(21)7-10(2)8-14(16)22;/h5-8H,3-4H2,1-2H3;1H4/b23-17-,24-18-; |
| InChIKey | GDPZUHOTMQQNLV-MGDDWPMISA-N |
| XLogP | 9.23 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.12 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|