C14H13IN2 — CID 141484740
(2,6-dimethylphenyl)-(4-iodophenyl)diazene (PubChem CID 141484740) has the molecular formula C14H13IN2 and a molecular weight of 336.18 g/mol. Its IUPAC name is (2,6-dimethylphenyl)-(4-iodophenyl)diazene.
| Compound Name | (2,6-dimethylphenyl)-(4-iodophenyl)diazene |
|---|---|
| PubChem CID | 141484740 |
| Molecular Formula | C14H13IN2 |
| Molecular Weight | 336.18 g/mol |
| Exact Mass | 336.01 |
| IUPAC Name | (2,6-dimethylphenyl)-(4-iodophenyl)diazene |
| SMILES | Cc1cccc(C)c1/N=N/c1ccc(I)cc1 |
| InChI | InChI=1S/C14H13IN2/c1-10-4-3-5-11(2)14(10)17-16-13-8-6-12(15)7-9-13/h3-9H,1-2H3/b17-16+ |
| InChIKey | WLKCUUKAICGRPD-WUKNDPDISA-N |
| XLogP | 5.32 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.18 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|