C20H19N5 — CID 86015373
N-[(2,6-dimethylphenyl)diazenyl]-4-phenyldiazenylaniline (PubChem CID 86015373) has the molecular formula C20H19N5 and a molecular weight of 329.41 g/mol. Its IUPAC name is N-[(2,6-dimethylphenyl)diazenyl]-4-phenyldiazenylaniline.
| Compound Name | N-[(2,6-dimethylphenyl)diazenyl]-4-phenyldiazenylaniline |
|---|---|
| PubChem CID | 86015373 |
| Molecular Formula | C20H19N5 |
| Molecular Weight | 329.41 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | N-[(2,6-dimethylphenyl)diazenyl]-4-phenyldiazenylaniline |
| SMILES | Cc1cccc(C)c1/N=N/Nc1ccc(/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C20H19N5/c1-15-7-6-8-16(2)20(15)24-25-23-19-13-11-18(12-14-19)22-21-17-9-4-3-5-10-17/h3-14H,1-2H3,(H,23,24)/b22-21+ |
| InChIKey | KYGCRIRACAJUHB-QURGRASLSA-N |
| XLogP | 6.83 |
| TPSA | 61.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.41 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|