C27H32N6 — CID 159282713
2-methylaniline;2-methylbenzene-1,4-diamine;2-methyl-4-phenyldiazenylaniline (PubChem CID 159282713) has the molecular formula C27H32N6 and a molecular weight of 440.60 g/mol. Its IUPAC name is 2-methylaniline;2-methylbenzene-1,4-diamine;2-methyl-4-phenyldiazenylaniline.
| Compound Name | 2-methylaniline;2-methylbenzene-1,4-diamine;2-methyl-4-phenyldiazenylaniline |
|---|---|
| PubChem CID | 159282713 |
| Molecular Formula | C27H32N6 |
| Molecular Weight | 440.60 g/mol |
| Exact Mass | 440.27 |
| IUPAC Name | 2-methylaniline;2-methylbenzene-1,4-diamine;2-methyl-4-phenyldiazenylaniline |
| SMILES | Cc1cc(/N=N/c2ccccc2)ccc1N.Cc1cc(N)ccc1N.Cc1ccccc1N |
| InChI | InChI=1S/C13H13N3.C7H10N2.C7H9N/c1-10-9-12(7-8-13(10)14)16-15-11-5-3-2-4-6-11;1-5-4-6(8)2-3-7(5)9;1-6-4-2-3-5-7(6)8/h2-9H,14H2,1H3;2-4H,8-9H2,1H3;2-5H,8H2,1H3/b16-15+;; |
| InChIKey | KZCWIGKDHAHBRH-VRZXRVJBSA-N |
| XLogP | 6.73 |
| TPSA | 128.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.60 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|