C26H24N4O2 — CID 578807
4-[[7-[(4-hydroxy-2,6-dimethylphenyl)diazenyl]naphthalen-2-yl]diazenyl]-3,5-dimethylphenol (PubChem CID 578807) has the molecular formula C26H24N4O2 and a molecular weight of 424.50 g/mol. Its IUPAC name is 4-[[7-[(4-hydroxy-2,6-dimethylphenyl)diazenyl]naphthalen-2-yl]diazenyl]-3,5-dimethylphenol.
| Compound Name | 4-[[7-[(4-hydroxy-2,6-dimethylphenyl)diazenyl]naphthalen-2-yl]diazenyl]-3,5-dimethylphenol |
|---|---|
| PubChem CID | 578807 |
| Molecular Formula | C26H24N4O2 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 4-[[7-[(4-hydroxy-2,6-dimethylphenyl)diazenyl]naphthalen-2-yl]diazenyl]-3,5-dimethylphenol |
| SMILES | Cc1cc(O)cc(C)c1/N=N/c1ccc2ccc(/N=N/c3c(C)cc(O)cc3C)cc2c1 |
| InChI | InChI=1S/C26H24N4O2/c1-15-9-23(31)10-16(2)25(15)29-27-21-7-5-19-6-8-22(14-20(19)13-21)28-30-26-17(3)11-24(32)12-18(26)4/h5-14,31-32H,1-4H3/b29-27+,30-28+ |
| InChIKey | BUKZIHKZRYUUFZ-QAVVBOBSSA-N |
| XLogP | 8.32 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|