C24H20N4O2 — CID 136671063
1,8-bis[(4-methylphenyl)diazenyl]naphthalene-2,7-diol (PubChem CID 136671063) has the molecular formula C24H20N4O2 and a molecular weight of 396.45 g/mol. Its IUPAC name is 1,8-bis[(4-methylphenyl)diazenyl]naphthalene-2,7-diol.
| Compound Name | 1,8-bis[(4-methylphenyl)diazenyl]naphthalene-2,7-diol |
|---|---|
| PubChem CID | 136671063 |
| Molecular Formula | C24H20N4O2 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 1,8-bis[(4-methylphenyl)diazenyl]naphthalene-2,7-diol |
| SMILES | Cc1ccc(/N=N/c2c(O)ccc3ccc(O)c(/N=N/c4ccc(C)cc4)c23)cc1 |
| InChI | InChI=1S/C24H20N4O2/c1-15-3-9-18(10-4-15)25-27-23-20(29)13-7-17-8-14-21(30)24(22(17)23)28-26-19-11-5-16(2)6-12-19/h3-14,29-30H,1-2H3/b27-25+,28-26+ |
| InChIKey | AKWOSBQGRPCOKQ-NBHCHVEOSA-N |
| XLogP | 7.70 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|