C17H14N2O4 — CID 135471441
6,7-dihydroxy-4-methyl-8-[(4-methylphenyl)diazenyl]chromen-2-one (PubChem CID 135471441) has the molecular formula C17H14N2O4 and a molecular weight of 310.31 g/mol. Its IUPAC name is 6,7-dihydroxy-4-methyl-8-[(4-methylphenyl)diazenyl]chromen-2-one.
| Compound Name | 6,7-dihydroxy-4-methyl-8-[(4-methylphenyl)diazenyl]chromen-2-one |
|---|---|
| PubChem CID | 135471441 |
| Molecular Formula | C17H14N2O4 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 6,7-dihydroxy-4-methyl-8-[(4-methylphenyl)diazenyl]chromen-2-one |
| SMILES | Cc1ccc(/N=N/c2c(O)c(O)cc3c(C)cc(=O)oc23)cc1 |
| InChI | InChI=1S/C17H14N2O4/c1-9-3-5-11(6-4-9)18-19-15-16(22)13(20)8-12-10(2)7-14(21)23-17(12)15/h3-8,20,22H,1-2H3/b19-18+ |
| InChIKey | OOBYTHCDLXYRIE-VHEBQXMUSA-N |
| XLogP | 4.24 |
| TPSA | 95.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|