C28H28N4O3 — CID 137243500
7-hydroxy-4-methyl-6,8-bis[(E)-C-methyl-N-(3-methylanilino)carbonimidoyl]chromen-2-one (PubChem CID 137243500) has the molecular formula C28H28N4O3 and a molecular weight of 468.56 g/mol. Its IUPAC name is 7-hydroxy-4-methyl-6,8-bis[(E)-C-methyl-N-(3-methylanilino)carbonimidoyl]chromen-2-one.
| Compound Name | 7-hydroxy-4-methyl-6,8-bis[(E)-C-methyl-N-(3-methylanilino)carbonimidoyl]chromen-2-one |
|---|---|
| PubChem CID | 137243500 |
| Molecular Formula | C28H28N4O3 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | 7-hydroxy-4-methyl-6,8-bis[(E)-C-methyl-N-(3-methylanilino)carbonimidoyl]chromen-2-one |
| SMILES | C/C(=N\Nc1cccc(C)c1)c1cc2c(C)cc(=O)oc2c(/C(C)=N/Nc2cccc(C)c2)c1O |
| InChI | InChI=1S/C28H28N4O3/c1-16-8-6-10-21(12-16)31-29-19(4)24-15-23-18(3)14-25(33)35-28(23)26(27(24)34)20(5)30-32-22-11-7-9-17(2)13-22/h6-15,31-32,34H,1-5H3/b29-19+,30-20+ |
| InChIKey | ZXXHEEFGIKAYOO-CZYCKNNWSA-N |
| XLogP | 6.10 |
| TPSA | 99.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|