C14H12Br2N2O — CID 137308244
2-[(E)-N-anilino-C-methylcarbonimidoyl]-4,6-dibromophenol (PubChem CID 137308244) has the molecular formula C14H12Br2N2O and a molecular weight of 384.07 g/mol. Its IUPAC name is 2-[(E)-N-anilino-C-methylcarbonimidoyl]-4,6-dibromophenol.
| Compound Name | 2-[(E)-N-anilino-C-methylcarbonimidoyl]-4,6-dibromophenol |
|---|---|
| PubChem CID | 137308244 |
| Molecular Formula | C14H12Br2N2O |
| Molecular Weight | 384.07 g/mol |
| Exact Mass | 381.93 |
| IUPAC Name | 2-[(E)-N-anilino-C-methylcarbonimidoyl]-4,6-dibromophenol |
| SMILES | C/C(=N\Nc1ccccc1)c1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C14H12Br2N2O/c1-9(17-18-11-5-3-2-4-6-11)12-7-10(15)8-13(16)14(12)19/h2-8,18-19H,1H3/b17-9+ |
| InChIKey | DKVLQWACCYWUID-RQZCQDPDSA-N |
| XLogP | 4.75 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.07 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|