C15H12Br2N2O2 — CID 137125205
N-[1-(3,5-dibromo-2-hydroxyphenyl)ethylideneamino]benzamide (PubChem CID 137125205) has the molecular formula C15H12Br2N2O2 and a molecular weight of 412.08 g/mol. Its IUPAC name is N-[1-(3,5-dibromo-2-hydroxyphenyl)ethylideneamino]benzamide.
| Compound Name | N-[1-(3,5-dibromo-2-hydroxyphenyl)ethylideneamino]benzamide |
|---|---|
| PubChem CID | 137125205 |
| Molecular Formula | C15H12Br2N2O2 |
| Molecular Weight | 412.08 g/mol |
| Exact Mass | 409.93 |
| IUPAC Name | N-[1-(3,5-dibromo-2-hydroxyphenyl)ethylideneamino]benzamide |
| SMILES | CC(=NNC(=O)c1ccccc1)c1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C15H12Br2N2O2/c1-9(12-7-11(16)8-13(17)14(12)20)18-19-15(21)10-5-3-2-4-6-10/h2-8,20H,1H3,(H,19,21) |
| InChIKey | ZSASRXIFYLMBHF-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.08 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|