C23H28N4O — CID 25192981
N-[1-[(Z)-[1-(cyanoamino)-2-(2-methylphenyl)ethylidene]amino]-2,2-dimethylpropyl]-2-phenylacetamide (PubChem CID 25192981) has the molecular formula C23H28N4O and a molecular weight of 376.50 g/mol. Its IUPAC name is N-[1-[(Z)-[1-(cyanoamino)-2-(2-methylphenyl)ethylidene]amino]-2,2-dimethylpropyl]-2-phenylacetamide.
| Compound Name | N-[1-[(Z)-[1-(cyanoamino)-2-(2-methylphenyl)ethylidene]amino]-2,2-dimethylpropyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 25192981 |
| Molecular Formula | C23H28N4O |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | N-[1-[(Z)-[1-(cyanoamino)-2-(2-methylphenyl)ethylidene]amino]-2,2-dimethylpropyl]-2-phenylacetamide |
| SMILES | Cc1ccccc1C/C(=N/C(NC(=O)Cc1ccccc1)C(C)(C)C)NC#N |
| InChI | InChI=1S/C23H28N4O/c1-17-10-8-9-13-19(17)15-20(25-16-24)26-22(23(2,3)4)27-21(28)14-18-11-6-5-7-12-18/h5-13,22H,14-15H2,1-4H3,(H,25,26)(H,27,28) |
| InChIKey | DKOVFCSCLUQUPQ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 77.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|