C24H32N6O — CID 74022753
N-[1-[[(cyanoamino)-[(2-methyl-3-pyridinyl)amino]methylidene]amino]-2,2-dimethylpropyl]-5-phenylpentanamide (PubChem CID 74022753) has the molecular formula C24H32N6O and a molecular weight of 420.56 g/mol. Its IUPAC name is N-[1-[[(cyanoamino)-[(2-methyl-3-pyridinyl)amino]methylidene]amino]-2,2-dimethylpropyl]-5-phenylpentanamide.
| Compound Name | N-[1-[[(cyanoamino)-[(2-methyl-3-pyridinyl)amino]methylidene]amino]-2,2-dimethylpropyl]-5-phenylpentanamide |
|---|---|
| PubChem CID | 74022753 |
| Molecular Formula | C24H32N6O |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.26 |
| IUPAC Name | N-[1-[[(cyanoamino)-[(2-methyl-3-pyridinyl)amino]methylidene]amino]-2,2-dimethylpropyl]-5-phenylpentanamide |
| SMILES | Cc1ncccc1NC(=NC(NC(=O)CCCCc1ccccc1)C(C)(C)C)NC#N |
| InChI | InChI=1S/C24H32N6O/c1-18-20(14-10-16-26-18)28-23(27-17-25)30-22(24(2,3)4)29-21(31)15-9-8-13-19-11-6-5-7-12-19/h5-7,10-12,14,16,22H,8-9,13,15H2,1-4H3,(H,29,31)(H2,27,28,30) |
| InChIKey | XGRCVEJUDOLNQP-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|