C20H20N2O3 — CID 67360670
(3R)-4-(2-cyanophenyl)-3-[[2-(2-methylphenyl)acetyl]amino]butanoic acid (PubChem CID 67360670) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is (3R)-4-(2-cyanophenyl)-3-[[2-(2-methylphenyl)acetyl]amino]butanoic acid.
| Compound Name | (3R)-4-(2-cyanophenyl)-3-[[2-(2-methylphenyl)acetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 67360670 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | (3R)-4-(2-cyanophenyl)-3-[[2-(2-methylphenyl)acetyl]amino]butanoic acid |
| SMILES | Cc1ccccc1CC(=O)N[C@@H](CC(=O)O)Cc1ccccc1C#N |
| InChI | InChI=1S/C20H20N2O3/c1-14-6-2-3-7-15(14)11-19(23)22-18(12-20(24)25)10-16-8-4-5-9-17(16)13-21/h2-9,18H,10-12H2,1H3,(H,22,23)(H,24,25)/t18-/m1/s1 |
| InChIKey | HYCGPNAUOWRBFP-GOSISDBHSA-N |
| XLogP | 2.61 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |