C18H29IN2O3S — CID 171377205
N-[1-(benzylamino)-4-dimethylsulfonio-1-oxobutan-2-yl]-1-[(2-methylpropan-2-yl)oxy]methanimidate;hydroiodide (PubChem CID 171377205) has the molecular formula C18H29IN2O3S and a molecular weight of 480.41 g/mol. Its IUPAC name is N-[1-(benzylamino)-4-dimethylsulfonio-1-oxobutan-2-yl]-1-[(2-methylpropan-2-yl)oxy]methanimidate;hydroiodide.
| Compound Name | N-[1-(benzylamino)-4-dimethylsulfonio-1-oxobutan-2-yl]-1-[(2-methylpropan-2-yl)oxy]methanimidate;hydroiodide |
|---|---|
| PubChem CID | 171377205 |
| Molecular Formula | C18H29IN2O3S |
| Molecular Weight | 480.41 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | N-[1-(benzylamino)-4-dimethylsulfonio-1-oxobutan-2-yl]-1-[(2-methylpropan-2-yl)oxy]methanimidate;hydroiodide |
| SMILES | C[S+](C)CCC(/N=C(\[O-])OC(C)(C)C)C(=O)NCc1ccccc1.I |
| InChI | InChI=1S/C18H28N2O3S.HI/c1-18(2,3)23-17(22)20-15(11-12-24(4)5)16(21)19-13-14-9-7-6-8-10-14;/h6-10,15H,11-13H2,1-5H3,(H-,19,20,21,22);1H |
| InChIKey | WAGZNVRMXIGMCY-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 73.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.41 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|