C25H41NO2 — CID 159253076
2-(tert-butylamino)-7,7-dimethyl-5-pentyl-1-phenyloctane-3,6-dione (PubChem CID 159253076) has the molecular formula C25H41NO2 and a molecular weight of 387.61 g/mol. Its IUPAC name is 2-(tert-butylamino)-7,7-dimethyl-5-pentyl-1-phenyloctane-3,6-dione.
| Compound Name | 2-(tert-butylamino)-7,7-dimethyl-5-pentyl-1-phenyloctane-3,6-dione |
|---|---|
| PubChem CID | 159253076 |
| Molecular Formula | C25H41NO2 |
| Molecular Weight | 387.61 g/mol |
| Exact Mass | 387.31 |
| IUPAC Name | 2-(tert-butylamino)-7,7-dimethyl-5-pentyl-1-phenyloctane-3,6-dione |
| SMILES | CCCCCC(CC(=O)C(Cc1ccccc1)NC(C)(C)C)C(=O)C(C)(C)C |
| InChI | InChI=1S/C25H41NO2/c1-8-9-11-16-20(23(28)24(2,3)4)18-22(27)21(26-25(5,6)7)17-19-14-12-10-13-15-19/h10,12-15,20-21,26H,8-9,11,16-18H2,1-7H3 |
| InChIKey | ZJLCXUDGIFAKHH-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.61 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|