C42H62O8 — CID 139659018
(2R,3R)-2,3-bis[(2R)-2-benzyldodecanoyl]-2,3-dihydroxybutanedioic acid (PubChem CID 139659018) has the molecular formula C42H62O8 and a molecular weight of 694.95 g/mol. Its IUPAC name is (2R,3R)-2,3-bis[(2R)-2-benzyldodecanoyl]-2,3-dihydroxybutanedioic acid.
| Compound Name | (2R,3R)-2,3-bis[(2R)-2-benzyldodecanoyl]-2,3-dihydroxybutanedioic acid |
|---|---|
| PubChem CID | 139659018 |
| Molecular Formula | C42H62O8 |
| Molecular Weight | 694.95 g/mol |
| Exact Mass | 694.44 |
| IUPAC Name | (2R,3R)-2,3-bis[(2R)-2-benzyldodecanoyl]-2,3-dihydroxybutanedioic acid |
| SMILES | CCCCCCCCCC[C@H](Cc1ccccc1)C(=O)[C@@](O)(C(=O)O)[C@](O)(C(=O)O)C(=O)[C@H](CCCCCCCCCC)Cc1ccccc1 |
| InChI | InChI=1S/C42H62O8/c1-3-5-7-9-11-13-15-23-29-35(31-33-25-19-17-20-26-33)37(43)41(49,39(45)46)42(50,40(47)48)38(44)36(32-34-27-21-18-22-28-34)30-24-16-14-12-10-8-6-4-2/h17-22,25-28,35-36,49-50H,3-16,23-24,29-32H2,1-2H3,(H,45,46)(H,47,48)/t35-,36-,41-,42-/m1/s1 |
| InChIKey | IJCJWLUHZBPIRO-BELZKUCLSA-N |
| XLogP | 8.54 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.95 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|