C26H44O2 — CID 150055079
2-benzyl-4-hexyl-4-methyldodecanoic acid (PubChem CID 150055079) has the molecular formula C26H44O2 and a molecular weight of 388.64 g/mol. Its IUPAC name is 2-benzyl-4-hexyl-4-methyldodecanoic acid.
| Compound Name | 2-benzyl-4-hexyl-4-methyldodecanoic acid |
|---|---|
| PubChem CID | 150055079 |
| Molecular Formula | C26H44O2 |
| Molecular Weight | 388.64 g/mol |
| Exact Mass | 388.33 |
| IUPAC Name | 2-benzyl-4-hexyl-4-methyldodecanoic acid |
| SMILES | CCCCCCCCC(C)(CCCCCC)CC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C26H44O2/c1-4-6-8-10-11-16-20-26(3,19-15-9-7-5-2)22-24(25(27)28)21-23-17-13-12-14-18-23/h12-14,17-18,24H,4-11,15-16,19-22H2,1-3H3,(H,27,28) |
| InChIKey | DMCRKNCMLSJYKL-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.64 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|