C18H27NO2 — CID 159234420
N-[(2R)-4,4-dimethyl-3-oxo-1-phenylpentan-2-yl]pentanamide (PubChem CID 159234420) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is N-[(2R)-4,4-dimethyl-3-oxo-1-phenylpentan-2-yl]pentanamide.
| Compound Name | N-[(2R)-4,4-dimethyl-3-oxo-1-phenylpentan-2-yl]pentanamide |
|---|---|
| PubChem CID | 159234420 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | N-[(2R)-4,4-dimethyl-3-oxo-1-phenylpentan-2-yl]pentanamide |
| SMILES | CCCCC(=O)N[C@H](Cc1ccccc1)C(=O)C(C)(C)C |
| InChI | InChI=1S/C18H27NO2/c1-5-6-12-16(20)19-15(17(21)18(2,3)4)13-14-10-8-7-9-11-14/h7-11,15H,5-6,12-13H2,1-4H3,(H,19,20)/t15-/m1/s1 |
| InChIKey | DIPUTTYVVWRHDB-OAHLLOKOSA-N |
| XLogP | 3.52 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |