C24H35NO5 — CID 162094335
methyl (2S)-2-[[(2R,5S)-2-benzyl-5-methyl-4-oxodecanoyl]amino]-4-oxopentanoate (PubChem CID 162094335) has the molecular formula C24H35NO5 and a molecular weight of 417.55 g/mol. Its IUPAC name is methyl (2S)-2-[[(2R,5S)-2-benzyl-5-methyl-4-oxodecanoyl]amino]-4-oxopentanoate.
| Compound Name | methyl (2S)-2-[[(2R,5S)-2-benzyl-5-methyl-4-oxodecanoyl]amino]-4-oxopentanoate |
|---|---|
| PubChem CID | 162094335 |
| Molecular Formula | C24H35NO5 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.25 |
| IUPAC Name | methyl (2S)-2-[[(2R,5S)-2-benzyl-5-methyl-4-oxodecanoyl]amino]-4-oxopentanoate |
| SMILES | CCCCC[C@H](C)C(=O)C[C@@H](Cc1ccccc1)C(=O)N[C@@H](CC(C)=O)C(=O)OC |
| InChI | InChI=1S/C24H35NO5/c1-5-6-8-11-17(2)22(27)16-20(15-19-12-9-7-10-13-19)23(28)25-21(14-18(3)26)24(29)30-4/h7,9-10,12-13,17,20-21H,5-6,8,11,14-16H2,1-4H3,(H,25,28)/t17-,20+,21-/m0/s1 |
| InChIKey | SVPUOUHXXLERJB-WMQCIHAUSA-N |
| XLogP | 3.66 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|